C13H16BrNO3 — CID 114185326
2-bromo-6-(2-but-3-enoxyethylamino)benzoic acid (PubChem CID 114185326) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-bromo-6-(2-but-3-enoxyethylamino)benzoic acid.
| Compound Name | 2-bromo-6-(2-but-3-enoxyethylamino)benzoic acid |
|---|---|
| PubChem CID | 114185326 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-bromo-6-(2-but-3-enoxyethylamino)benzoic acid |
| SMILES | C=CCCOCCNc1cccc(Br)c1C(=O)O |
| InChI | InChI=1S/C13H16BrNO3/c1-2-3-8-18-9-7-15-11-6-4-5-10(14)12(11)13(16)17/h2,4-6,15H,1,3,7-9H2,(H,16,17) |
| InChIKey | VBJOSKQBZXFUPG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|