C25H40O3Si — CID 11418629
(5R,6R)-6-acetyl-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 11418629) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is (5R,6R)-6-acetyl-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-acetyl-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11418629 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (5R,6R)-6-acetyl-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C/CC[C@@]1(C(C)=O)C(=O)C(C)=CC[C@@H]1C(=C)C |
| InChI | InChI=1S/C25H40O3Si/c1-17(2)22-15-14-19(4)23(27)25(22,21(6)26)16-12-13-18(3)20(5)28-29(10,11)24(7,8)9/h13-14,22H,1,5,12,15-16H2,2-4,6-11H3/b18-13+/t22-,25+/m1/s1 |
| InChIKey | PMAHTDQGSOZELB-ZKZOWUIZSA-N |
| XLogP | 6.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|