C24H40O2Si — CID 11101172
(5R,6R)-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 11101172) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (5R,6R)-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11101172 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (5R,6R)-6-[(3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dienyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C/CC[C@@]1(C)C(=O)C(C)=CC[C@@H]1C(=C)C |
| InChI | InChI=1S/C24H40O2Si/c1-17(2)21-15-14-19(4)22(25)24(21,9)16-12-13-18(3)20(5)26-27(10,11)23(6,7)8/h13-14,21H,1,5,12,15-16H2,2-4,6-11H3/b18-13+/t21-,24-/m1/s1 |
| InChIKey | JWPMMJBOLSONGA-UBIQIYROSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|