C11H13BrF3NS2 — CID 114187463
2-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 114187463) has the molecular formula C11H13BrF3NS2 and a molecular weight of 360.26 g/mol. Its IUPAC name is 2-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 114187463 |
| Molecular Formula | C11H13BrF3NS2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-bromo-N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)(F)SCCNC1CCCc2sc(Br)cc21 |
| InChI | InChI=1S/C11H13BrF3NS2/c12-10-6-7-8(2-1-3-9(7)18-10)16-4-5-17-11(13,14)15/h6,8,16H,1-5H2 |
| InChIKey | XFZGZGHJTMIUDA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|