C12H16BrNO2S — CID 82690234
4-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]butanoic acid (PubChem CID 82690234) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]butanoic acid.
| Compound Name | 4-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 82690234 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC1CCCc2sc(Br)cc21 |
| InChI | InChI=1S/C12H16BrNO2S/c13-11-7-8-9(3-1-4-10(8)17-11)14-6-2-5-12(15)16/h7,9,14H,1-6H2,(H,15,16) |
| InChIKey | FJHGQZNEDQKEFH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|