C15H27ClN2 — CID 114188949
1-(3-chloro-2-methylprop-2-enyl)-5-cyclopropyl-5-methyl-2-propylpiperazine (PubChem CID 114188949) has the molecular formula C15H27ClN2 and a molecular weight of 270.85 g/mol. Its IUPAC name is 1-(3-chloro-2-methylprop-2-enyl)-5-cyclopropyl-5-methyl-2-propylpiperazine.
| Compound Name | 1-(3-chloro-2-methylprop-2-enyl)-5-cyclopropyl-5-methyl-2-propylpiperazine |
|---|---|
| PubChem CID | 114188949 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(3-chloro-2-methylprop-2-enyl)-5-cyclopropyl-5-methyl-2-propylpiperazine |
| SMILES | CCCC1CNC(C)(C2CC2)CN1CC(C)=CCl |
| InChI | InChI=1S/C15H27ClN2/c1-4-5-14-9-17-15(3,13-6-7-13)11-18(14)10-12(2)8-16/h8,13-14,17H,4-7,9-11H2,1-3H3 |
| InChIKey | IRYDYUMHOILHAS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |