C10H16ClNO — CID 106439867
1-(3-chloro-2-methylprop-2-enyl)-3-cyclopropylazetidin-3-ol (PubChem CID 106439867) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is 1-(3-chloro-2-methylprop-2-enyl)-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-(3-chloro-2-methylprop-2-enyl)-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 106439867 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-(3-chloro-2-methylprop-2-enyl)-3-cyclopropylazetidin-3-ol |
| SMILES | CC(=CCl)CN1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C10H16ClNO/c1-8(4-11)5-12-6-10(13,7-12)9-2-3-9/h4,9,13H,2-3,5-7H2,1H3 |
| InChIKey | MFVNTHZLPZYVLM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |