C10H15F3N2O3 — CID 114189971
2-[4-(3,3,3-trifluoropropanoylamino)piperidin-4-yl]acetic acid (PubChem CID 114189971) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[4-(3,3,3-trifluoropropanoylamino)piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-(3,3,3-trifluoropropanoylamino)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 114189971 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-[4-(3,3,3-trifluoropropanoylamino)piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)CC(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C10H15F3N2O3/c11-10(12,13)5-7(16)15-9(6-8(17)18)1-3-14-4-2-9/h14H,1-6H2,(H,15,16)(H,17,18) |
| InChIKey | CYKUTQMXWMEDFL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |