C15H19FOS — CID 114190169
1-(2-fluorophenyl)sulfanyl-6,6-dimethylhept-4-yn-2-ol (PubChem CID 114190169) has the molecular formula C15H19FOS and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-6,6-dimethylhept-4-yn-2-ol.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-6,6-dimethylhept-4-yn-2-ol |
|---|---|
| PubChem CID | 114190169 |
| Molecular Formula | C15H19FOS |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-6,6-dimethylhept-4-yn-2-ol |
| SMILES | CC(C)(C)C#CCC(O)CSc1ccccc1F |
| InChI | InChI=1S/C15H19FOS/c1-15(2,3)10-6-7-12(17)11-18-14-9-5-4-8-13(14)16/h4-5,8-9,12,17H,7,11H2,1-3H3 |
| InChIKey | SKMWPVDRYYSEPJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|