C15H20ClN — CID 114190215
1-(4-chlorophenyl)-6,6-dimethylhept-4-yn-2-amine (PubChem CID 114190215) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,6-dimethylhept-4-yn-2-amine.
| Compound Name | 1-(4-chlorophenyl)-6,6-dimethylhept-4-yn-2-amine |
|---|---|
| PubChem CID | 114190215 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(4-chlorophenyl)-6,6-dimethylhept-4-yn-2-amine |
| SMILES | CC(C)(C)C#CCC(N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClN/c1-15(2,3)10-4-5-14(17)11-12-6-8-13(16)9-7-12/h6-9,14H,5,11,17H2,1-3H3 |
| InChIKey | HDAPSFGBNJUYQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|