C15H20ClNO — CID 114190590
1-(4-chlorophenoxy)-6,6-dimethylhept-4-yn-2-amine (PubChem CID 114190590) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-6,6-dimethylhept-4-yn-2-amine.
| Compound Name | 1-(4-chlorophenoxy)-6,6-dimethylhept-4-yn-2-amine |
|---|---|
| PubChem CID | 114190590 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(4-chlorophenoxy)-6,6-dimethylhept-4-yn-2-amine |
| SMILES | CC(C)(C)C#CCC(N)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO/c1-15(2,3)10-4-5-13(17)11-18-14-8-6-12(16)7-9-14/h6-9,13H,5,11,17H2,1-3H3 |
| InChIKey | VHCZEPQIPRHMSK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|