C8H7Cl3O — CID 143327001
1-chloro-4-(2,2-dichloroethoxy)benzene (PubChem CID 143327001) has the molecular formula C8H7Cl3O and a molecular weight of 225.50 g/mol. Its IUPAC name is 1-chloro-4-(2,2-dichloroethoxy)benzene.
| Compound Name | 1-chloro-4-(2,2-dichloroethoxy)benzene |
|---|---|
| PubChem CID | 143327001 |
| Molecular Formula | C8H7Cl3O |
| Molecular Weight | 225.50 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 1-chloro-4-(2,2-dichloroethoxy)benzene |
| SMILES | Clc1ccc(OCC(Cl)Cl)cc1 |
| InChI | InChI=1S/C8H7Cl3O/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4,8H,5H2 |
| InChIKey | VPXPKTRUSKSEPT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|