C19H33N3O8 — CID 11419025
tert-butyl (4S,5R)-4-[[2-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11419025) has the molecular formula C19H33N3O8 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[[2-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[[2-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11419025 |
| Molecular Formula | C19H33N3O8 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl (4S,5R)-4-[[2-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]amino]-2-oxoethyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H](NC(=O)CNC(=O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)OC(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C19H33N3O8/c1-10(23)13(16(26)28-8)21-12(24)9-20-15(25)14-11(2)29-19(6,7)22(14)17(27)30-18(3,4)5/h10-11,13-14,23H,9H2,1-8H3,(H,20,25)(H,21,24)/t10-,11-,13+,14+/m1/s1 |
| InChIKey | VNJNTIHQMHDORW-RFHZTLPTSA-N |
| XLogP | -0.10 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |