C20H38N2O7 — CID 171379504
tert-butyl (4R,5R)-4-[(1R)-2-acetamido-3,3-diethoxy-1-hydroxypropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 171379504) has the molecular formula C20H38N2O7 and a molecular weight of 418.53 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[(1R)-2-acetamido-3,3-diethoxy-1-hydroxypropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[(1R)-2-acetamido-3,3-diethoxy-1-hydroxypropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 171379504 |
| Molecular Formula | C20H38N2O7 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | tert-butyl (4R,5R)-4-[(1R)-2-acetamido-3,3-diethoxy-1-hydroxypropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(OCC)C(NC(C)=O)[C@@H](O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N2O7/c1-10-26-17(27-11-2)14(21-13(4)23)16(24)15-12(3)28-20(8,9)22(15)18(25)29-19(5,6)7/h12,14-17,24H,10-11H2,1-9H3,(H,21,23)/t12-,14?,15+,16-/m1/s1 |
| InChIKey | GHOZWULDZRUIQI-QSBXLFSZSA-N |
| XLogP | 2.01 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|