C18H34N2O8 — CID 102525375
tert-butyl (4S,5R)-4-[(1S,2R)-3,3-diethoxy-1-hydroxy-2-nitropropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 102525375) has the molecular formula C18H34N2O8 and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[(1S,2R)-3,3-diethoxy-1-hydroxy-2-nitropropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[(1S,2R)-3,3-diethoxy-1-hydroxy-2-nitropropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102525375 |
| Molecular Formula | C18H34N2O8 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | tert-butyl (4S,5R)-4-[(1S,2R)-3,3-diethoxy-1-hydroxy-2-nitropropyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(OCC)[C@@H]([C@@H](O)[C@H]1[C@@H](C)OC(C)(C)N1C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C18H34N2O8/c1-9-25-15(26-10-2)13(20(23)24)14(21)12-11(3)27-18(7,8)19(12)16(22)28-17(4,5)6/h11-15,21H,9-10H2,1-8H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | GTKLIPOXGWNUHQ-SYQHCUMBSA-N |
| XLogP | 2.15 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|