C17H29NO8S — CID 10916548
tert-butyl (4S,5R)-4-[(E,1R)-4-methoxy-1-methylsulfonyloxy-4-oxobut-2-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10916548) has the molecular formula C17H29NO8S and a molecular weight of 407.49 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[(E,1R)-4-methoxy-1-methylsulfonyloxy-4-oxobut-2-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[(E,1R)-4-methoxy-1-methylsulfonyloxy-4-oxobut-2-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10916548 |
| Molecular Formula | C17H29NO8S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | tert-butyl (4S,5R)-4-[(E,1R)-4-methoxy-1-methylsulfonyloxy-4-oxobut-2-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)/C=C/[C@@H](OS(C)(=O)=O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO8S/c1-11-14(12(26-27(8,21)22)9-10-13(19)23-7)18(17(5,6)24-11)15(20)25-16(2,3)4/h9-12,14H,1-8H3/b10-9+/t11-,12-,14+/m1/s1 |
| InChIKey | SRWIKZAVKSCINX-WMAAAFJKSA-N |
| XLogP | 1.82 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|