C14H25NO2 — CID 114190361
1-(4-methoxyoxan-4-yl)-5,5-dimethylhex-3-yn-1-amine (PubChem CID 114190361) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(4-methoxyoxan-4-yl)-5,5-dimethylhex-3-yn-1-amine.
| Compound Name | 1-(4-methoxyoxan-4-yl)-5,5-dimethylhex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190361 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-(4-methoxyoxan-4-yl)-5,5-dimethylhex-3-yn-1-amine |
| SMILES | COC1(C(N)CC#CC(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C14H25NO2/c1-13(2,3)7-5-6-12(15)14(16-4)8-10-17-11-9-14/h12H,6,8-11,15H2,1-4H3 |
| InChIKey | FNGUECKUIHWYPB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|