C11H20F3NO2 — CID 116764437
5,5,5-trifluoro-1-(4-methoxyoxan-4-yl)pentan-1-amine (PubChem CID 116764437) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(4-methoxyoxan-4-yl)pentan-1-amine.
| Compound Name | 5,5,5-trifluoro-1-(4-methoxyoxan-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 116764437 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5,5,5-trifluoro-1-(4-methoxyoxan-4-yl)pentan-1-amine |
| SMILES | COC1(C(N)CCCC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C11H20F3NO2/c1-16-10(5-7-17-8-6-10)9(15)3-2-4-11(12,13)14/h9H,2-8,15H2,1H3 |
| InChIKey | HMWPYQYXYLYZPY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |