C13H24F3NO2 — CID 116765669
1-(4-ethoxyoxan-4-yl)-5,5,5-trifluoro-N-methylpentan-1-amine (PubChem CID 116765669) has the molecular formula C13H24F3NO2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-(4-ethoxyoxan-4-yl)-5,5,5-trifluoro-N-methylpentan-1-amine.
| Compound Name | 1-(4-ethoxyoxan-4-yl)-5,5,5-trifluoro-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 116765669 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-(4-ethoxyoxan-4-yl)-5,5,5-trifluoro-N-methylpentan-1-amine |
| SMILES | CCOC1(C(CCCC(F)(F)F)NC)CCOCC1 |
| InChI | InChI=1S/C13H24F3NO2/c1-3-19-12(7-9-18-10-8-12)11(17-2)5-4-6-13(14,15)16/h11,17H,3-10H2,1-2H3 |
| InChIKey | ZXZSQTWUIKIPKR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |