C16H30F3NO — CID 116764230
1-(1-ethoxycyclohexyl)-5,5,5-trifluoro-N-propylpentan-1-amine (PubChem CID 116764230) has the molecular formula C16H30F3NO and a molecular weight of 309.42 g/mol. Its IUPAC name is 1-(1-ethoxycyclohexyl)-5,5,5-trifluoro-N-propylpentan-1-amine.
| Compound Name | 1-(1-ethoxycyclohexyl)-5,5,5-trifluoro-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 116764230 |
| Molecular Formula | C16H30F3NO |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-(1-ethoxycyclohexyl)-5,5,5-trifluoro-N-propylpentan-1-amine |
| SMILES | CCCNC(CCCC(F)(F)F)C1(OCC)CCCCC1 |
| InChI | InChI=1S/C16H30F3NO/c1-3-13-20-14(9-8-12-16(17,18)19)15(21-4-2)10-6-5-7-11-15/h14,20H,3-13H2,1-2H3 |
| InChIKey | QRQOWAJABQSDOY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |