C14H22N2S — CID 114190580
N-ethyl-5,5-dimethyl-1-(2-methyl-1,3-thiazol-5-yl)hex-3-yn-1-amine (PubChem CID 114190580) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-ethyl-5,5-dimethyl-1-(2-methyl-1,3-thiazol-5-yl)hex-3-yn-1-amine.
| Compound Name | N-ethyl-5,5-dimethyl-1-(2-methyl-1,3-thiazol-5-yl)hex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190580 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-ethyl-5,5-dimethyl-1-(2-methyl-1,3-thiazol-5-yl)hex-3-yn-1-amine |
| SMILES | CCNC(CC#CC(C)(C)C)c1cnc(C)s1 |
| InChI | InChI=1S/C14H22N2S/c1-6-15-12(8-7-9-14(3,4)5)13-10-16-11(2)17-13/h10,12,15H,6,8H2,1-5H3 |
| InChIKey | FLSHQOACRLANFN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|