C15H22ClNS — CID 114190643
1-(5-chlorothiophen-2-yl)-5,5-dimethyl-N-propylhex-3-yn-1-amine (PubChem CID 114190643) has the molecular formula C15H22ClNS and a molecular weight of 283.87 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-5,5-dimethyl-N-propylhex-3-yn-1-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-5,5-dimethyl-N-propylhex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190643 |
| Molecular Formula | C15H22ClNS |
| Molecular Weight | 283.87 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-5,5-dimethyl-N-propylhex-3-yn-1-amine |
| SMILES | CCCNC(CC#CC(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H22ClNS/c1-5-11-17-12(7-6-10-15(2,3)4)13-8-9-14(16)18-13/h8-9,12,17H,5,7,11H2,1-4H3 |
| InChIKey | UQZMJLMRIJWQSD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|