C13H22ClNOS — CID 116720675
1-(5-chlorothiophen-2-yl)-2-methoxy-3-methyl-N-propylbutan-1-amine (PubChem CID 116720675) has the molecular formula C13H22ClNOS and a molecular weight of 275.85 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-methoxy-3-methyl-N-propylbutan-1-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-methoxy-3-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 116720675 |
| Molecular Formula | C13H22ClNOS |
| Molecular Weight | 275.85 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-methoxy-3-methyl-N-propylbutan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)s1)C(OC)C(C)C |
| InChI | InChI=1S/C13H22ClNOS/c1-5-8-15-12(13(16-4)9(2)3)10-6-7-11(14)17-10/h6-7,9,12-13,15H,5,8H2,1-4H3 |
| InChIKey | GKLUBHVUZNNRIK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |