C14H16BrClO — CID 114190717
1-(2-bromo-4-chlorophenyl)-5,5-dimethylhex-3-yn-1-ol (PubChem CID 114190717) has the molecular formula C14H16BrClO and a molecular weight of 315.64 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-5,5-dimethylhex-3-yn-1-ol.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-5,5-dimethylhex-3-yn-1-ol |
|---|---|
| PubChem CID | 114190717 |
| Molecular Formula | C14H16BrClO |
| Molecular Weight | 315.64 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-5,5-dimethylhex-3-yn-1-ol |
| SMILES | CC(C)(C)C#CCC(O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C14H16BrClO/c1-14(2,3)8-4-5-13(17)11-7-6-10(16)9-12(11)15/h6-7,9,13,17H,5H2,1-3H3 |
| InChIKey | XQDQSUWIKCKIKF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|