C15H19BrClN — CID 114190566
1-(3-bromo-5-chlorophenyl)-N,5,5-trimethylhex-3-yn-1-amine (PubChem CID 114190566) has the molecular formula C15H19BrClN and a molecular weight of 328.68 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-N,5,5-trimethylhex-3-yn-1-amine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-N,5,5-trimethylhex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190566 |
| Molecular Formula | C15H19BrClN |
| Molecular Weight | 328.68 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-N,5,5-trimethylhex-3-yn-1-amine |
| SMILES | CNC(CC#CC(C)(C)C)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C15H19BrClN/c1-15(2,3)7-5-6-14(18-4)11-8-12(16)10-13(17)9-11/h8-10,14,18H,6H2,1-4H3 |
| InChIKey | UZDLGYPQNCDJGQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|