C26H27NO3S — CID 11419111
ethyl 4-(dibenzylamino)-4-oxo-2-phenylsulfanylbutanoate (PubChem CID 11419111) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is ethyl 4-(dibenzylamino)-4-oxo-2-phenylsulfanylbutanoate.
| Compound Name | ethyl 4-(dibenzylamino)-4-oxo-2-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 11419111 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | ethyl 4-(dibenzylamino)-4-oxo-2-phenylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CC(=O)N(Cc1ccccc1)Cc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C26H27NO3S/c1-2-30-26(29)24(31-23-16-10-5-11-17-23)18-25(28)27(19-21-12-6-3-7-13-21)20-22-14-8-4-9-15-22/h3-17,24H,2,18-20H2,1H3 |
| InChIKey | PNAQNJZHKLKZNG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |