C28H29NO3S2 — CID 11092190
[(1S)-1-[(2S,3S)-2-[bis(phenylsulfanyl)methyl]-4-oxo-1-[(1S)-1-phenylethyl]azetidin-3-yl]ethyl] acetate (PubChem CID 11092190) has the molecular formula C28H29NO3S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is [(1S)-1-[(2S,3S)-2-[bis(phenylsulfanyl)methyl]-4-oxo-1-[(1S)-1-phenylethyl]azetidin-3-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(2S,3S)-2-[bis(phenylsulfanyl)methyl]-4-oxo-1-[(1S)-1-phenylethyl]azetidin-3-yl]ethyl] acetate |
|---|---|
| PubChem CID | 11092190 |
| Molecular Formula | C28H29NO3S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [(1S)-1-[(2S,3S)-2-[bis(phenylsulfanyl)methyl]-4-oxo-1-[(1S)-1-phenylethyl]azetidin-3-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@H]1C(=O)N([C@@H](C)c2ccccc2)[C@@H]1C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H29NO3S2/c1-19(22-13-7-4-8-14-22)29-26(25(27(29)31)20(2)32-21(3)30)28(33-23-15-9-5-10-16-23)34-24-17-11-6-12-18-24/h4-20,25-26,28H,1-3H3/t19-,20-,25+,26-/m0/s1 |
| InChIKey | VTCDREAEHDALHH-GLDZPFRISA-N |
| XLogP | 6.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|