C21H21NO3S2 — CID 11516876
ethyl (6S,7S)-8-oxo-6-phenyl-7-phenylsulfanyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate (PubChem CID 11516876) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is ethyl (6S,7S)-8-oxo-6-phenyl-7-phenylsulfanyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate.
| Compound Name | ethyl (6S,7S)-8-oxo-6-phenyl-7-phenylsulfanyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| PubChem CID | 11516876 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl (6S,7S)-8-oxo-6-phenyl-7-phenylsulfanyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Sc2ccccc2)C(=O)N2CCCS[C@]21c1ccccc1 |
| InChI | InChI=1S/C21H21NO3S2/c1-2-25-19(24)20(27-17-12-7-4-8-13-17)18(23)22-14-9-15-26-21(20,22)16-10-5-3-6-11-16/h3-8,10-13H,2,9,14-15H2,1H3/t20-,21-/m0/s1 |
| InChIKey | KAOSBGNEXZTTGQ-SFTDATJTSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|