C15H17NO3S — CID 11529417
ethyl (6R,7S)-8-oxo-6-phenyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate (PubChem CID 11529417) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl (6R,7S)-8-oxo-6-phenyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate.
| Compound Name | ethyl (6R,7S)-8-oxo-6-phenyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate |
|---|---|
| PubChem CID | 11529417 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl (6R,7S)-8-oxo-6-phenyl-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)N2CCCS[C@@]12c1ccccc1 |
| InChI | InChI=1S/C15H17NO3S/c1-2-19-14(18)12-13(17)16-9-6-10-20-15(12,16)11-7-4-3-5-8-11/h3-5,7-8,12H,2,6,9-10H2,1H3/t12-,15-/m0/s1 |
| InChIKey | VXIUDRZRIWSHNF-WFASDCNBSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|