C22H23NO5S — CID 11697297
ethyl (3S,4S)-1-(2-ethoxy-2-oxoethyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate (PubChem CID 11697297) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is ethyl (3S,4S)-1-(2-ethoxy-2-oxoethyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate.
| Compound Name | ethyl (3S,4S)-1-(2-ethoxy-2-oxoethyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11697297 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | ethyl (3S,4S)-1-(2-ethoxy-2-oxoethyl)-2-oxo-4-phenyl-3-phenylsulfanylazetidine-3-carboxylate |
| SMILES | CCOC(=O)CN1C(=O)[C@](Sc2ccccc2)(C(=O)OCC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5S/c1-3-27-18(24)15-23-19(16-11-7-5-8-12-16)22(20(23)25,21(26)28-4-2)29-17-13-9-6-10-14-17/h5-14,19H,3-4,15H2,1-2H3/t19-,22-/m0/s1 |
| InChIKey | FGJJXOLSOLYZON-UGKGYDQZSA-N |
| XLogP | 3.23 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|