C20H21NO3S — CID 54148459
methyl 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-3-phenylpropanoate (PubChem CID 54148459) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is methyl 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-3-phenylpropanoate.
| Compound Name | methyl 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 54148459 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl 2-(2-benzylsulfanyl-4-oxoazetidin-1-yl)-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1C(=O)CC1SCc1ccccc1 |
| InChI | InChI=1S/C20H21NO3S/c1-24-20(23)17(12-15-8-4-2-5-9-15)21-18(22)13-19(21)25-14-16-10-6-3-7-11-16/h2-11,17,19H,12-14H2,1H3 |
| InChIKey | OGANAGFSLFRXKW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |