C18H17NO3S — CID 58843843
[(3S,4S)-1-methyl-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl] acetate (PubChem CID 58843843) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is [(3S,4S)-1-methyl-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl] acetate.
| Compound Name | [(3S,4S)-1-methyl-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 58843843 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [(3S,4S)-1-methyl-2-oxo-4-phenyl-3-phenylsulfanylazetidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@]1(Sc2ccccc2)C(=O)N(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17NO3S/c1-13(20)22-18(23-15-11-7-4-8-12-15)16(19(2)17(18)21)14-9-5-3-6-10-14/h3-12,16H,1-2H3/t16-,18-/m0/s1 |
| InChIKey | LRKIQTDNFMUZLW-WMZOPIPTSA-N |
| XLogP | 3.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|