C17H14FNO3S — CID 16726903
[(2S,3S)-2-(4-fluorophenyl)-4-oxo-1-phenylsulfanylazetidin-3-yl] acetate (PubChem CID 16726903) has the molecular formula C17H14FNO3S and a molecular weight of 331.37 g/mol. Its IUPAC name is [(2S,3S)-2-(4-fluorophenyl)-4-oxo-1-phenylsulfanylazetidin-3-yl] acetate.
| Compound Name | [(2S,3S)-2-(4-fluorophenyl)-4-oxo-1-phenylsulfanylazetidin-3-yl] acetate |
|---|---|
| PubChem CID | 16726903 |
| Molecular Formula | C17H14FNO3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [(2S,3S)-2-(4-fluorophenyl)-4-oxo-1-phenylsulfanylazetidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N(Sc2ccccc2)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FNO3S/c1-11(20)22-16-15(12-7-9-13(18)10-8-12)19(17(16)21)23-14-5-3-2-4-6-14/h2-10,15-16H,1H3/t15-,16-/m0/s1 |
| InChIKey | CATSDVODSZQAQS-HOTGVXAUSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|