C21H21NO2S — CID 139191639
(6S,7S)-7-methoxy-2,2-dimethyl-4,5-diphenyl-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one (PubChem CID 139191639) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is (6S,7S)-7-methoxy-2,2-dimethyl-4,5-diphenyl-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one.
| Compound Name | (6S,7S)-7-methoxy-2,2-dimethyl-4,5-diphenyl-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one |
|---|---|
| PubChem CID | 139191639 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (6S,7S)-7-methoxy-2,2-dimethyl-4,5-diphenyl-3-thia-1-azabicyclo[4.2.0]oct-4-en-8-one |
| SMILES | CO[C@@H]1C(=O)N2[C@H]1C(c1ccccc1)=C(c1ccccc1)SC2(C)C |
| InChI | InChI=1S/C21H21NO2S/c1-21(2)22-17(18(24-3)20(22)23)16(14-10-6-4-7-11-14)19(25-21)15-12-8-5-9-13-15/h4-13,17-18H,1-3H3/t17-,18-/m0/s1 |
| InChIKey | VXLWJHIFLMHFNC-ROUUACIJSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|