C16H23NO2 — CID 162413146
(3R,4S)-1-hexyl-3-methoxy-4-phenylazetidin-2-one (PubChem CID 162413146) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (3R,4S)-1-hexyl-3-methoxy-4-phenylazetidin-2-one.
| Compound Name | (3R,4S)-1-hexyl-3-methoxy-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 162413146 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (3R,4S)-1-hexyl-3-methoxy-4-phenylazetidin-2-one |
| SMILES | CCCCCCN1C(=O)[C@H](OC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-3-4-5-9-12-17-14(15(19-2)16(17)18)13-10-7-6-8-11-13/h6-8,10-11,14-15H,3-5,9,12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | GKTFBNQALPWVRL-LSDHHAIUSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|