C21H25NO3S — CID 101092115
ethyl (2S,3R)-3-morpholin-4-yl-3-phenyl-2-phenylsulfanylpropanoate (PubChem CID 101092115) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is ethyl (2S,3R)-3-morpholin-4-yl-3-phenyl-2-phenylsulfanylpropanoate.
| Compound Name | ethyl (2S,3R)-3-morpholin-4-yl-3-phenyl-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 101092115 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | ethyl (2S,3R)-3-morpholin-4-yl-3-phenyl-2-phenylsulfanylpropanoate |
| SMILES | CCOC(=O)[C@@H](Sc1ccccc1)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H25NO3S/c1-2-25-21(23)20(26-18-11-7-4-8-12-18)19(17-9-5-3-6-10-17)22-13-15-24-16-14-22/h3-12,19-20H,2,13-16H2,1H3/t19-,20+/m1/s1 |
| InChIKey | ANJOYAKMDYQFSB-UXHICEINSA-N |
| XLogP | 3.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |