C19H23NO2S — CID 52945836
methyl (2R)-2-phenyl-2-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]acetate (PubChem CID 52945836) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is methyl (2R)-2-phenyl-2-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]acetate.
| Compound Name | methyl (2R)-2-phenyl-2-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 52945836 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl (2R)-2-phenyl-2-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccccc1)[C@H]1CCCCN1Cc1cccs1 |
| InChI | InChI=1S/C19H23NO2S/c1-22-19(21)18(15-8-3-2-4-9-15)17-11-5-6-12-20(17)14-16-10-7-13-23-16/h2-4,7-10,13,17-18H,5-6,11-12,14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | XGTZBGNNSZZVLK-QZTJIDSGSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |