C17H24O — CID 114191686
2-(2-cyclohexylethyl)-1,3-dihydroinden-2-ol (PubChem CID 114191686) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(2-cyclohexylethyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 114191686 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-(2-cyclohexylethyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(CCC2CCCCC2)Cc2ccccc2C1 |
| InChI | InChI=1S/C17H24O/c18-17(11-10-14-6-2-1-3-7-14)12-15-8-4-5-9-16(15)13-17/h4-5,8-9,14,18H,1-3,6-7,10-13H2 |
| InChIKey | XNLSHYPLLVJTIY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |