C15H29ClN2 — CID 114192641
1-(2-chloroethyl)-4-(2-cyclohexylethyl)-1,4-diazepane (PubChem CID 114192641) has the molecular formula C15H29ClN2 and a molecular weight of 272.86 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(2-cyclohexylethyl)-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(2-cyclohexylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 114192641 |
| Molecular Formula | C15H29ClN2 |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1-(2-chloroethyl)-4-(2-cyclohexylethyl)-1,4-diazepane |
| SMILES | ClCCN1CCCN(CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H29ClN2/c16-8-12-18-10-4-9-17(13-14-18)11-7-15-5-2-1-3-6-15/h15H,1-14H2 |
| InChIKey | QGLCCAKHPMBZNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|