C12H16BrN3O2 — CID 114194006
2-amino-5-bromo-N-methyl-N-(2-methyloxolan-3-yl)pyridine-4-carboxamide (PubChem CID 114194006) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 2-amino-5-bromo-N-methyl-N-(2-methyloxolan-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-amino-5-bromo-N-methyl-N-(2-methyloxolan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114194006 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-amino-5-bromo-N-methyl-N-(2-methyloxolan-3-yl)pyridine-4-carboxamide |
| SMILES | CC1OCCC1N(C)C(=O)c1cc(N)ncc1Br |
| InChI | InChI=1S/C12H16BrN3O2/c1-7-10(3-4-18-7)16(2)12(17)8-5-11(14)15-6-9(8)13/h5-7,10H,3-4H2,1-2H3,(H2,14,15) |
| InChIKey | HMGQZWBRUINTAY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |