C13H16N4OS — CID 114194969
2-amino-5-[methyl(1-thiophen-2-ylethyl)amino]pyridine-4-carboxamide (PubChem CID 114194969) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-amino-5-[methyl(1-thiophen-2-ylethyl)amino]pyridine-4-carboxamide.
| Compound Name | 2-amino-5-[methyl(1-thiophen-2-ylethyl)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114194969 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-amino-5-[methyl(1-thiophen-2-ylethyl)amino]pyridine-4-carboxamide |
| SMILES | CC(c1cccs1)N(C)c1cnc(N)cc1C(N)=O |
| InChI | InChI=1S/C13H16N4OS/c1-8(11-4-3-5-19-11)17(2)10-7-16-12(14)6-9(10)13(15)18/h3-8H,1-2H3,(H2,14,16)(H2,15,18) |
| InChIKey | PJVPWGZSNDMHQX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |