C13H15N3O2S — CID 81439113
5-amino-6-[methyl(1-thiophen-2-ylethyl)amino]pyridine-3-carboxylic acid (PubChem CID 81439113) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 5-amino-6-[methyl(1-thiophen-2-ylethyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-6-[methyl(1-thiophen-2-ylethyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81439113 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-amino-6-[methyl(1-thiophen-2-ylethyl)amino]pyridine-3-carboxylic acid |
| SMILES | CC(c1cccs1)N(C)c1ncc(C(=O)O)cc1N |
| InChI | InChI=1S/C13H15N3O2S/c1-8(11-4-3-5-19-11)16(2)12-10(14)6-9(7-15-12)13(17)18/h3-8H,14H2,1-2H3,(H,17,18) |
| InChIKey | MFGFEOGCSAVVNM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |