C12H19N5O2 — CID 114195291
2-amino-5-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridine-4-carboxamide (PubChem CID 114195291) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-amino-5-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridine-4-carboxamide.
| Compound Name | 2-amino-5-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114195291 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-amino-5-[[2-(tert-butylamino)-2-oxoethyl]amino]pyridine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNc1cnc(N)cc1C(N)=O |
| InChI | InChI=1S/C12H19N5O2/c1-12(2,3)17-10(18)6-15-8-5-16-9(13)4-7(8)11(14)19/h4-5,15H,6H2,1-3H3,(H2,13,16)(H2,14,19)(H,17,18) |
| InChIKey | CYNVMHLGQQKGKX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |