C12H19N3O3S — CID 114195371
methyl 2-amino-5-(3-methylsulfinylbutylamino)pyridine-4-carboxylate (PubChem CID 114195371) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 2-amino-5-(3-methylsulfinylbutylamino)pyridine-4-carboxylate.
| Compound Name | methyl 2-amino-5-(3-methylsulfinylbutylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114195371 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 2-amino-5-(3-methylsulfinylbutylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(N)ncc1NCCC(C)S(C)=O |
| InChI | InChI=1S/C12H19N3O3S/c1-8(19(3)17)4-5-14-10-7-15-11(13)6-9(10)12(16)18-2/h6-8,14H,4-5H2,1-3H3,(H2,13,15) |
| InChIKey | LHJMOVRZTVFHTG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |