C13H21NO4S — CID 115924392
methyl 2-methyl-5-[(3-methylsulfinylbutylamino)methyl]furan-3-carboxylate (PubChem CID 115924392) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is methyl 2-methyl-5-[(3-methylsulfinylbutylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(3-methylsulfinylbutylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 115924392 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 2-methyl-5-[(3-methylsulfinylbutylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CNCCC(C)S(C)=O)oc1C |
| InChI | InChI=1S/C13H21NO4S/c1-9(19(4)16)5-6-14-8-11-7-12(10(2)18-11)13(15)17-3/h7,9,14H,5-6,8H2,1-4H3 |
| InChIKey | YJNQDFWGKKRNSN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|