C13H17NO3 — CID 103923406
methyl 2-methyl-5-[(pent-4-ynylamino)methyl]furan-3-carboxylate (PubChem CID 103923406) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl 2-methyl-5-[(pent-4-ynylamino)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(pent-4-ynylamino)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 103923406 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl 2-methyl-5-[(pent-4-ynylamino)methyl]furan-3-carboxylate |
| SMILES | C#CCCCNCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C13H17NO3/c1-4-5-6-7-14-9-11-8-12(10(2)17-11)13(15)16-3/h1,8,14H,5-7,9H2,2-3H3 |
| InChIKey | HNHSBKCUMVOKFA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|