C15H26N2O3 — CID 43219152
methyl 5-[[3-(diethylamino)propylamino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 43219152) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 5-[[3-(diethylamino)propylamino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[3-(diethylamino)propylamino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 43219152 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | methyl 5-[[3-(diethylamino)propylamino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN(CC)CCCNCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C15H26N2O3/c1-5-17(6-2)9-7-8-16-11-13-10-14(12(3)20-13)15(18)19-4/h10,16H,5-9,11H2,1-4H3 |
| InChIKey | GIVAMAHXJYUVJI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|