C14H16BrNO3S — CID 103626098
methyl 5-[[2-(5-bromothiophen-2-yl)ethylamino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 103626098) has the molecular formula C14H16BrNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is methyl 5-[[2-(5-bromothiophen-2-yl)ethylamino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[2-(5-bromothiophen-2-yl)ethylamino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 103626098 |
| Molecular Formula | C14H16BrNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | methyl 5-[[2-(5-bromothiophen-2-yl)ethylamino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CNCCc2ccc(Br)s2)oc1C |
| InChI | InChI=1S/C14H16BrNO3S/c1-9-12(14(17)18-2)7-10(19-9)8-16-6-5-11-3-4-13(15)20-11/h3-4,7,16H,5-6,8H2,1-2H3 |
| InChIKey | GPKULKSESDZVBB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|