C12H8F2N2O3 — CID 114195658
2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid (PubChem CID 114195658) has the molecular formula C12H8F2N2O3 and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid.
| Compound Name | 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114195658 |
| Molecular Formula | C12H8F2N2O3 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)c(Oc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C12H8F2N2O3/c13-8-2-1-6(3-9(8)14)19-10-5-16-11(15)4-7(10)12(17)18/h1-5H,(H2,15,16)(H,17,18) |
| InChIKey | OWMITUVFOBURKP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |