2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid

C12H8F2N2O3 — CID 114195658

IUPAC2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid
SMILESNc1cc(C(=O)O)c(Oc2ccc(F)c(F)c2)cn1
InChIInChI=1S/C12H8F2N2O3/c13-8-2-1-6(3-9(8)14)19-10-5-16-11(15)4-7(10)12(17)18/h1-5H,(H2,15,16)(H,17,18)
InChIKeyOWMITUVFOBURKP-UHFFFAOYSA-N
MW266.20 g/mol
LogP2.43
Rot. Bonds3

About 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid

2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid (PubChem CID 114195658) has the molecular formula C12H8F2N2O3 and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid
PubChem CID114195658
Molecular FormulaC12H8F2N2O3
Molecular Weight266.20 g/mol
Exact Mass266.05
IUPAC Name2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid
SMILESNc1cc(C(=O)O)c(Oc2ccc(F)c(F)c2)cn1
InChIInChI=1S/C12H8F2N2O3/c13-8-2-1-6(3-9(8)14)19-10-5-16-11(15)4-7(10)12(17)18/h1-5H,(H2,15,16)(H,17,18)
InChIKeyOWMITUVFOBURKP-UHFFFAOYSA-N
XLogP2.43
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.20
LogP ≤ 52.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid?
The IUPAC name of 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid (CID 114195658) is 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid?
The canonical SMILES for 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid is Nc1cc(C(=O)O)c(Oc2ccc(F)c(F)c2)cn1.
What is the InChIKey of 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid?
The InChIKey is OWMITUVFOBURKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2O3/c13-8-2-1-6(3-9(8)14)19-10-5-16-11(15)4-7(10)12(17)18/h1-5H,(H2,15,16)(H,17,18).
What are the key properties of 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid?
2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid has a molecular weight of 266.20 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(3,4-difluorophenoxy)pyridine-4-carboxylic acid is sourced from PubChem (CID 114195658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).