C7H7F2N3O5 — CID 175491653
2-amino-5-(difluoromethoxy)pyridine-4-carboxylic acid;nitrous acid (PubChem CID 175491653) has the molecular formula C7H7F2N3O5 and a molecular weight of 251.14 g/mol. Its IUPAC name is 2-amino-5-(difluoromethoxy)pyridine-4-carboxylic acid;nitrous acid.
| Compound Name | 2-amino-5-(difluoromethoxy)pyridine-4-carboxylic acid;nitrous acid |
|---|---|
| PubChem CID | 175491653 |
| Molecular Formula | C7H7F2N3O5 |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-amino-5-(difluoromethoxy)pyridine-4-carboxylic acid;nitrous acid |
| SMILES | Nc1cc(C(=O)O)c(OC(F)F)cn1.O=NO |
| InChI | InChI=1S/C7H6F2N2O3.HNO2/c8-7(9)14-4-2-11-5(10)1-3(4)6(12)13;2-1-3/h1-2,7H,(H2,10,11)(H,12,13);(H,2,3) |
| InChIKey | SADAFLKPFMSQNV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|